C19H14N6O2S3 — CID 55413708
N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 55413708) has the molecular formula C19H14N6O2S3 and a molecular weight of 454.56 g/mol. Its IUPAC name is N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 55413708 |
| Molecular Formula | C19H14N6O2S3 |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.03 |
| IUPAC Name | N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1c(C(=O)Nc2nnc(SCc3ccc(C#N)cc3)s2)sc2ncn(C)c(=O)c12 |
| InChI | InChI=1S/C19H14N6O2S3/c1-10-13-16(21-9-25(2)17(13)27)29-14(10)15(26)22-18-23-24-19(30-18)28-8-12-5-3-11(7-20)4-6-12/h3-6,9H,8H2,1-2H3,(H,22,23,26) |
| InChIKey | JJGNMCUUHOXKGN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 113.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|