C17H10Cl2N4OS2 — CID 112766939
2,6-dichloro-N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 112766939) has the molecular formula C17H10Cl2N4OS2 and a molecular weight of 421.33 g/mol. Its IUPAC name is 2,6-dichloro-N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2,6-dichloro-N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 112766939 |
| Molecular Formula | C17H10Cl2N4OS2 |
| Molecular Weight | 421.33 g/mol |
| Exact Mass | 419.97 |
| IUPAC Name | 2,6-dichloro-N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | N#Cc1ccc(CSc2nnc(NC(=O)c3c(Cl)cccc3Cl)s2)cc1 |
| InChI | InChI=1S/C17H10Cl2N4OS2/c18-12-2-1-3-13(19)14(12)15(24)21-16-22-23-17(26-16)25-9-11-6-4-10(8-20)5-7-11/h1-7H,9H2,(H,21,22,24) |
| InChIKey | YXRQROYHZOYJKN-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.33 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|