C17H18N6O2S2 — CID 52505837
1-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-[(3R)-2-oxoazepan-3-yl]urea (PubChem CID 52505837) has the molecular formula C17H18N6O2S2 and a molecular weight of 402.51 g/mol. Its IUPAC name is 1-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-[(3R)-2-oxoazepan-3-yl]urea.
| Compound Name | 1-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-[(3R)-2-oxoazepan-3-yl]urea |
|---|---|
| PubChem CID | 52505837 |
| Molecular Formula | C17H18N6O2S2 |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 1-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-[(3R)-2-oxoazepan-3-yl]urea |
| SMILES | N#Cc1ccc(CSc2nnc(NC(=O)N[C@@H]3CCCCNC3=O)s2)cc1 |
| InChI | InChI=1S/C17H18N6O2S2/c18-9-11-4-6-12(7-5-11)10-26-17-23-22-16(27-17)21-15(25)20-13-3-1-2-8-19-14(13)24/h4-7,13H,1-3,8,10H2,(H,19,24)(H2,20,21,22,25)/t13-/m1/s1 |
| InChIKey | ZQBKQEBURKCISA-CYBMUJFWSA-N |
| XLogP | 2.49 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|