C18H17F3N4OS2 — CID 51958201
cis-(1R,3S)-N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 51958201) has the molecular formula C18H17F3N4OS2 and a molecular weight of 426.49 g/mol. Its IUPAC name is cis-(1R,3S)-N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | cis-(1R,3S)-N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 51958201 |
| Molecular Formula | C18H17F3N4OS2 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | cis-(1R,3S)-N-[5-[(4-cyanophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | N#Cc1ccc(CSc2nnc(NC(=O)[C@@H]3CCC[C@H](C(F)(F)F)C3)s2)cc1 |
| InChI | InChI=1S/C18H17F3N4OS2/c19-18(20,21)14-3-1-2-13(8-14)15(26)23-16-24-25-17(28-16)27-10-12-6-4-11(9-22)5-7-12/h4-7,13-14H,1-3,8,10H2,(H,23,24,26)/t13-,14+/m1/s1 |
| InChIKey | QZLAYNKWUAXCBM-KGLIPLIRSA-N |
| XLogP | 5.01 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|