C15H20ClN3O3S — CID 40647452
1-[[2-(2-chloro-5-methylphenoxy)acetyl]amino]-3-[[(2R)-oxolan-2-yl]methyl]thiourea (PubChem CID 40647452) has the molecular formula C15H20ClN3O3S and a molecular weight of 357.86 g/mol. Its IUPAC name is 1-[[2-(2-chloro-5-methylphenoxy)acetyl]amino]-3-[[(2R)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[[2-(2-chloro-5-methylphenoxy)acetyl]amino]-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 40647452 |
| Molecular Formula | C15H20ClN3O3S |
| Molecular Weight | 357.86 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 1-[[2-(2-chloro-5-methylphenoxy)acetyl]amino]-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
| SMILES | Cc1ccc(Cl)c(OCC(=O)NNC(=S)NC[C@H]2CCCO2)c1 |
| InChI | InChI=1S/C15H20ClN3O3S/c1-10-4-5-12(16)13(7-10)22-9-14(20)18-19-15(23)17-8-11-3-2-6-21-11/h4-5,7,11H,2-3,6,8-9H2,1H3,(H,18,20)(H2,17,19,23)/t11-/m1/s1 |
| InChIKey | YERWLMYMTFLZPQ-LLVKDONJSA-N |
| XLogP | 1.70 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.86 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|