C16H23N5O2S — CID 52991456
1-(oxolan-2-ylmethyl)-3-[(5-phenylpyrazolidine-3-carbonyl)amino]thiourea (PubChem CID 52991456) has the molecular formula C16H23N5O2S and a molecular weight of 349.46 g/mol. Its IUPAC name is 1-(oxolan-2-ylmethyl)-3-[(5-phenylpyrazolidine-3-carbonyl)amino]thiourea.
| Compound Name | 1-(oxolan-2-ylmethyl)-3-[(5-phenylpyrazolidine-3-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 52991456 |
| Molecular Formula | C16H23N5O2S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 1-(oxolan-2-ylmethyl)-3-[(5-phenylpyrazolidine-3-carbonyl)amino]thiourea |
| SMILES | O=C(NNC(=S)NCC1CCCO1)C1CC(c2ccccc2)NN1 |
| InChI | InChI=1S/C16H23N5O2S/c22-15(20-21-16(24)17-10-12-7-4-8-23-12)14-9-13(18-19-14)11-5-2-1-3-6-11/h1-3,5-6,12-14,18-19H,4,7-10H2,(H,20,22)(H2,17,21,24) |
| InChIKey | CAZSBTHXHUYQLQ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 86.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|