C17H20N4O2S — CID 97018071
1-(naphthalen-2-ylcarbamothioylamino)-3-[[(2R)-oxolan-2-yl]methyl]urea (PubChem CID 97018071) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is 1-(naphthalen-2-ylcarbamothioylamino)-3-[[(2R)-oxolan-2-yl]methyl]urea.
| Compound Name | 1-(naphthalen-2-ylcarbamothioylamino)-3-[[(2R)-oxolan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 97018071 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 1-(naphthalen-2-ylcarbamothioylamino)-3-[[(2R)-oxolan-2-yl]methyl]urea |
| SMILES | O=C(NC[C@H]1CCCO1)NNC(=S)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H20N4O2S/c22-16(18-11-15-6-3-9-23-15)20-21-17(24)19-14-8-7-12-4-1-2-5-13(12)10-14/h1-2,4-5,7-8,10,15H,3,6,9,11H2,(H2,18,20,22)(H2,19,21,24)/t15-/m1/s1 |
| InChIKey | ILANVPAKWPFUCR-OAHLLOKOSA-N |
| XLogP | 2.52 |
| TPSA | 74.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|