C18H19BrN2OS2 — CID 4853256
1-[4-(4-bromophenyl)sulfanylphenyl]-3-(oxolan-2-ylmethyl)thiourea (PubChem CID 4853256) has the molecular formula C18H19BrN2OS2 and a molecular weight of 423.40 g/mol. Its IUPAC name is 1-[4-(4-bromophenyl)sulfanylphenyl]-3-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1-[4-(4-bromophenyl)sulfanylphenyl]-3-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 4853256 |
| Molecular Formula | C18H19BrN2OS2 |
| Molecular Weight | 423.40 g/mol |
| Exact Mass | 422.01 |
| IUPAC Name | 1-[4-(4-bromophenyl)sulfanylphenyl]-3-(oxolan-2-ylmethyl)thiourea |
| SMILES | S=C(NCC1CCCO1)Nc1ccc(Sc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C18H19BrN2OS2/c19-13-3-7-16(8-4-13)24-17-9-5-14(6-10-17)21-18(23)20-12-15-2-1-11-22-15/h3-10,15H,1-2,11-12H2,(H2,20,21,23) |
| InChIKey | WYWDYDMKNOKHJY-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.40 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|