C22H25N3O3S — CID 7484812
N-[[(2S)-oxolan-2-yl]methyl]-4-(3-phenylpropanoylcarbamothioylamino)benzamide (PubChem CID 7484812) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is N-[[(2S)-oxolan-2-yl]methyl]-4-(3-phenylpropanoylcarbamothioylamino)benzamide.
| Compound Name | N-[[(2S)-oxolan-2-yl]methyl]-4-(3-phenylpropanoylcarbamothioylamino)benzamide |
|---|---|
| PubChem CID | 7484812 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | N-[[(2S)-oxolan-2-yl]methyl]-4-(3-phenylpropanoylcarbamothioylamino)benzamide |
| SMILES | O=C(CCc1ccccc1)NC(=S)Nc1ccc(C(=O)NC[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C22H25N3O3S/c26-20(13-8-16-5-2-1-3-6-16)25-22(29)24-18-11-9-17(10-12-18)21(27)23-15-19-7-4-14-28-19/h1-3,5-6,9-12,19H,4,7-8,13-15H2,(H,23,27)(H2,24,25,26,29)/t19-/m0/s1 |
| InChIKey | BRMKKWJVDVVWHA-IBGZPJMESA-N |
| XLogP | 3.04 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|