C24H25NO4S — CID 92769085
ethyl 5-[(1S)-1-phenylethyl]-2-[(2-phenylmethoxyacetyl)amino]thiophene-3-carboxylate (PubChem CID 92769085) has the molecular formula C24H25NO4S and a molecular weight of 423.53 g/mol. Its IUPAC name is ethyl 5-[(1S)-1-phenylethyl]-2-[(2-phenylmethoxyacetyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-[(1S)-1-phenylethyl]-2-[(2-phenylmethoxyacetyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 92769085 |
| Molecular Formula | C24H25NO4S |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | ethyl 5-[(1S)-1-phenylethyl]-2-[(2-phenylmethoxyacetyl)amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc([C@@H](C)c2ccccc2)sc1NC(=O)COCc1ccccc1 |
| InChI | InChI=1S/C24H25NO4S/c1-3-29-24(27)20-14-21(17(2)19-12-8-5-9-13-19)30-23(20)25-22(26)16-28-15-18-10-6-4-7-11-18/h4-14,17H,3,15-16H2,1-2H3,(H,25,26)/t17-/m0/s1 |
| InChIKey | OXTYEQXIFDBEEZ-KRWDZBQOSA-N |
| XLogP | 5.23 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |