C19H23NO3S — CID 92759883
ethyl 2-(butanoylamino)-5-[(1R)-1-phenylethyl]thiophene-3-carboxylate (PubChem CID 92759883) has the molecular formula C19H23NO3S and a molecular weight of 345.46 g/mol. Its IUPAC name is ethyl 2-(butanoylamino)-5-[(1R)-1-phenylethyl]thiophene-3-carboxylate.
| Compound Name | ethyl 2-(butanoylamino)-5-[(1R)-1-phenylethyl]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 92759883 |
| Molecular Formula | C19H23NO3S |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | ethyl 2-(butanoylamino)-5-[(1R)-1-phenylethyl]thiophene-3-carboxylate |
| SMILES | CCCC(=O)Nc1sc([C@H](C)c2ccccc2)cc1C(=O)OCC |
| InChI | InChI=1S/C19H23NO3S/c1-4-9-17(21)20-18-15(19(22)23-5-2)12-16(24-18)13(3)14-10-7-6-8-11-14/h6-8,10-13H,4-5,9H2,1-3H3,(H,20,21)/t13-/m1/s1 |
| InChIKey | PCBJEFQXSHDYCV-CYBMUJFWSA-N |
| XLogP | 4.82 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |