C24H25NO4S — CID 92771089
ethyl 2-[(2-ethoxybenzoyl)amino]-5-[(1R)-1-phenylethyl]thiophene-3-carboxylate (PubChem CID 92771089) has the molecular formula C24H25NO4S and a molecular weight of 423.53 g/mol. Its IUPAC name is ethyl 2-[(2-ethoxybenzoyl)amino]-5-[(1R)-1-phenylethyl]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[(2-ethoxybenzoyl)amino]-5-[(1R)-1-phenylethyl]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 92771089 |
| Molecular Formula | C24H25NO4S |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | ethyl 2-[(2-ethoxybenzoyl)amino]-5-[(1R)-1-phenylethyl]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc([C@H](C)c2ccccc2)sc1NC(=O)c1ccccc1OCC |
| InChI | InChI=1S/C24H25NO4S/c1-4-28-20-14-10-9-13-18(20)22(26)25-23-19(24(27)29-5-2)15-21(30-23)16(3)17-11-7-6-8-12-17/h6-16H,4-5H2,1-3H3,(H,25,26)/t16-/m1/s1 |
| InChIKey | ICZHYQUOMYDYRE-MRXNPFEDSA-N |
| XLogP | 5.73 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |