C23H29NO3S — CID 92761246
ethyl 2-(3-cyclopentylpropanoylamino)-5-[(1R)-1-phenylethyl]thiophene-3-carboxylate (PubChem CID 92761246) has the molecular formula C23H29NO3S and a molecular weight of 399.56 g/mol. Its IUPAC name is ethyl 2-(3-cyclopentylpropanoylamino)-5-[(1R)-1-phenylethyl]thiophene-3-carboxylate.
| Compound Name | ethyl 2-(3-cyclopentylpropanoylamino)-5-[(1R)-1-phenylethyl]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 92761246 |
| Molecular Formula | C23H29NO3S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | ethyl 2-(3-cyclopentylpropanoylamino)-5-[(1R)-1-phenylethyl]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc([C@H](C)c2ccccc2)sc1NC(=O)CCC1CCCC1 |
| InChI | InChI=1S/C23H29NO3S/c1-3-27-23(26)19-15-20(16(2)18-11-5-4-6-12-18)28-22(19)24-21(25)14-13-17-9-7-8-10-17/h4-6,11-12,15-17H,3,7-10,13-14H2,1-2H3,(H,24,25)/t16-/m1/s1 |
| InChIKey | QIDLTQLDMMOPSX-MRXNPFEDSA-N |
| XLogP | 5.99 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |