C27H22N2O4S2 — CID 19677632
methyl 5-benzyl-2-[(2-methoxydibenzofuran-3-yl)carbamothioylamino]thiophene-3-carboxylate (PubChem CID 19677632) has the molecular formula C27H22N2O4S2 and a molecular weight of 502.62 g/mol. Its IUPAC name is methyl 5-benzyl-2-[(2-methoxydibenzofuran-3-yl)carbamothioylamino]thiophene-3-carboxylate.
| Compound Name | methyl 5-benzyl-2-[(2-methoxydibenzofuran-3-yl)carbamothioylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19677632 |
| Molecular Formula | C27H22N2O4S2 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | methyl 5-benzyl-2-[(2-methoxydibenzofuran-3-yl)carbamothioylamino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1cc(Cc2ccccc2)sc1NC(=S)Nc1cc2oc3ccccc3c2cc1OC |
| InChI | InChI=1S/C27H22N2O4S2/c1-31-24-14-19-18-10-6-7-11-22(18)33-23(19)15-21(24)28-27(34)29-25-20(26(30)32-2)13-17(35-25)12-16-8-4-3-5-9-16/h3-11,13-15H,12H2,1-2H3,(H2,28,29,34) |
| InChIKey | WTTUJWHEJPRWRJ-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 72.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|