C22H20N2O2S — CID 17267872
1-(3,5-dimethylphenyl)-3-(2-methoxydibenzofuran-3-yl)thiourea (PubChem CID 17267872) has the molecular formula C22H20N2O2S and a molecular weight of 376.48 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-(2-methoxydibenzofuran-3-yl)thiourea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-(2-methoxydibenzofuran-3-yl)thiourea |
|---|---|
| PubChem CID | 17267872 |
| Molecular Formula | C22H20N2O2S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-(2-methoxydibenzofuran-3-yl)thiourea |
| SMILES | COc1cc2c(cc1NC(=S)Nc1cc(C)cc(C)c1)oc1ccccc12 |
| InChI | InChI=1S/C22H20N2O2S/c1-13-8-14(2)10-15(9-13)23-22(27)24-18-12-20-17(11-21(18)25-3)16-6-4-5-7-19(16)26-20/h4-12H,1-3H3,(H2,23,24,27) |
| InChIKey | MJFBSRMHMTYVQY-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 46.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|