C26H20N2O3S — CID 23823921
1-(2-methoxydibenzofuran-3-yl)-3-(4-phenoxyphenyl)thiourea (PubChem CID 23823921) has the molecular formula C26H20N2O3S and a molecular weight of 440.52 g/mol. Its IUPAC name is 1-(2-methoxydibenzofuran-3-yl)-3-(4-phenoxyphenyl)thiourea.
| Compound Name | 1-(2-methoxydibenzofuran-3-yl)-3-(4-phenoxyphenyl)thiourea |
|---|---|
| PubChem CID | 23823921 |
| Molecular Formula | C26H20N2O3S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 1-(2-methoxydibenzofuran-3-yl)-3-(4-phenoxyphenyl)thiourea |
| SMILES | COc1cc2c(cc1NC(=S)Nc1ccc(Oc3ccccc3)cc1)oc1ccccc12 |
| InChI | InChI=1S/C26H20N2O3S/c1-29-25-15-21-20-9-5-6-10-23(20)31-24(21)16-22(25)28-26(32)27-17-11-13-19(14-12-17)30-18-7-3-2-4-8-18/h2-16H,1H3,(H2,27,28,32) |
| InChIKey | ANZFQNJURNLTEE-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 55.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|