C26H26ClNO3S — CID 46094994
ethyl 5-benzyl-2-[[1-(4-chlorophenyl)cyclopentanecarbonyl]amino]thiophene-3-carboxylate (PubChem CID 46094994) has the molecular formula C26H26ClNO3S and a molecular weight of 468.02 g/mol. Its IUPAC name is ethyl 5-benzyl-2-[[1-(4-chlorophenyl)cyclopentanecarbonyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-benzyl-2-[[1-(4-chlorophenyl)cyclopentanecarbonyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 46094994 |
| Molecular Formula | C26H26ClNO3S |
| Molecular Weight | 468.02 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | ethyl 5-benzyl-2-[[1-(4-chlorophenyl)cyclopentanecarbonyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(Cc2ccccc2)sc1NC(=O)C1(c2ccc(Cl)cc2)CCCC1 |
| InChI | InChI=1S/C26H26ClNO3S/c1-2-31-24(29)22-17-21(16-18-8-4-3-5-9-18)32-23(22)28-25(30)26(14-6-7-15-26)19-10-12-20(27)13-11-19/h3-5,8-13,17H,2,6-7,14-16H2,1H3,(H,28,30) |
| InChIKey | VPIARPYUXOMVCO-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.02 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |