C10H12FN3O3 — CID 112646669
3-[(3-fluoro-5-nitrophenyl)methylamino]propanamide (PubChem CID 112646669) has the molecular formula C10H12FN3O3 and a molecular weight of 241.22 g/mol. Its IUPAC name is 3-[(3-fluoro-5-nitrophenyl)methylamino]propanamide.
| Compound Name | 3-[(3-fluoro-5-nitrophenyl)methylamino]propanamide |
|---|---|
| PubChem CID | 112646669 |
| Molecular Formula | C10H12FN3O3 |
| Molecular Weight | 241.22 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 3-[(3-fluoro-5-nitrophenyl)methylamino]propanamide |
| SMILES | NC(=O)CCNCc1cc(F)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H12FN3O3/c11-8-3-7(4-9(5-8)14(16)17)6-13-2-1-10(12)15/h3-5,13H,1-2,6H2,(H2,12,15) |
| InChIKey | MKOMGZKQZIPBIB-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.22 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|