C14H19NOS — CID 113240149
N-[(2-ethoxyphenyl)methyl]-2-prop-2-ynylsulfanylethanamine (PubChem CID 113240149) has the molecular formula C14H19NOS and a molecular weight of 249.38 g/mol. Its IUPAC name is N-[(2-ethoxyphenyl)methyl]-2-prop-2-ynylsulfanylethanamine.
| Compound Name | N-[(2-ethoxyphenyl)methyl]-2-prop-2-ynylsulfanylethanamine |
|---|---|
| PubChem CID | 113240149 |
| Molecular Formula | C14H19NOS |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | N-[(2-ethoxyphenyl)methyl]-2-prop-2-ynylsulfanylethanamine |
| SMILES | C#CCSCCNCc1ccccc1OCC |
| InChI | InChI=1S/C14H19NOS/c1-3-10-17-11-9-15-12-13-7-5-6-8-14(13)16-4-2/h1,5-8,15H,4,9-12H2,2H3 |
| InChIKey | HPPPFJZEQZYFTG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|