C14H19NOS — CID 113320318
2-methylsulfanyl-N-[(2-prop-2-ynoxyphenyl)methyl]propan-1-amine (PubChem CID 113320318) has the molecular formula C14H19NOS and a molecular weight of 249.38 g/mol. Its IUPAC name is 2-methylsulfanyl-N-[(2-prop-2-ynoxyphenyl)methyl]propan-1-amine.
| Compound Name | 2-methylsulfanyl-N-[(2-prop-2-ynoxyphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 113320318 |
| Molecular Formula | C14H19NOS |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 2-methylsulfanyl-N-[(2-prop-2-ynoxyphenyl)methyl]propan-1-amine |
| SMILES | C#CCOc1ccccc1CNCC(C)SC |
| InChI | InChI=1S/C14H19NOS/c1-4-9-16-14-8-6-5-7-13(14)11-15-10-12(2)17-3/h1,5-8,12,15H,9-11H2,2-3H3 |
| InChIKey | ZNSGUQPONASKOY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|