C12H14N2O2 — CID 28607461
2-[(2-prop-2-ynoxyphenyl)methylamino]acetamide (PubChem CID 28607461) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-[(2-prop-2-ynoxyphenyl)methylamino]acetamide.
| Compound Name | 2-[(2-prop-2-ynoxyphenyl)methylamino]acetamide |
|---|---|
| PubChem CID | 28607461 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 2-[(2-prop-2-ynoxyphenyl)methylamino]acetamide |
| SMILES | C#CCOc1ccccc1CNCC(N)=O |
| InChI | InChI=1S/C12H14N2O2/c1-2-7-16-11-6-4-3-5-10(11)8-14-9-12(13)15/h1,3-6,14H,7-9H2,(H2,13,15) |
| InChIKey | QVNJYWPWPYEZAT-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|