C17H23NO3 — CID 43688899
methyl 4-methyl-2-[(2-prop-2-ynoxyphenyl)methylamino]pentanoate (PubChem CID 43688899) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is methyl 4-methyl-2-[(2-prop-2-ynoxyphenyl)methylamino]pentanoate.
| Compound Name | methyl 4-methyl-2-[(2-prop-2-ynoxyphenyl)methylamino]pentanoate |
|---|---|
| PubChem CID | 43688899 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | methyl 4-methyl-2-[(2-prop-2-ynoxyphenyl)methylamino]pentanoate |
| SMILES | C#CCOc1ccccc1CNC(CC(C)C)C(=O)OC |
| InChI | InChI=1S/C17H23NO3/c1-5-10-21-16-9-7-6-8-14(16)12-18-15(11-13(2)3)17(19)20-4/h1,6-9,13,15,18H,10-12H2,2-4H3 |
| InChIKey | GSHKUQWALLLJPH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|