C17H28N2O2 — CID 43674958
2-[(2-ethoxyphenyl)methylamino]-N,N,4-trimethylpentanamide (PubChem CID 43674958) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is 2-[(2-ethoxyphenyl)methylamino]-N,N,4-trimethylpentanamide.
| Compound Name | 2-[(2-ethoxyphenyl)methylamino]-N,N,4-trimethylpentanamide |
|---|---|
| PubChem CID | 43674958 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 2-[(2-ethoxyphenyl)methylamino]-N,N,4-trimethylpentanamide |
| SMILES | CCOc1ccccc1CNC(CC(C)C)C(=O)N(C)C |
| InChI | InChI=1S/C17H28N2O2/c1-6-21-16-10-8-7-9-14(16)12-18-15(11-13(2)3)17(20)19(4)5/h7-10,13,15,18H,6,11-12H2,1-5H3 |
| InChIKey | CFEUIZYOIPOYEW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |