C11H16N2O — CID 62392428
2-[(2-ethylphenyl)methylamino]acetamide (PubChem CID 62392428) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-[(2-ethylphenyl)methylamino]acetamide.
| Compound Name | 2-[(2-ethylphenyl)methylamino]acetamide |
|---|---|
| PubChem CID | 62392428 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 2-[(2-ethylphenyl)methylamino]acetamide |
| SMILES | CCc1ccccc1CNCC(N)=O |
| InChI | InChI=1S/C11H16N2O/c1-2-9-5-3-4-6-10(9)7-13-8-11(12)14/h3-6,13H,2,7-8H2,1H3,(H2,12,14) |
| InChIKey | RFJYRISQBUYZLJ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |