C14H21F2NO2 — CID 115526613
N-[[3-(difluoromethyl)phenyl]methyl]-2,2-diethoxyethanamine (PubChem CID 115526613) has the molecular formula C14H21F2NO2 and a molecular weight of 273.32 g/mol. Its IUPAC name is N-[[3-(difluoromethyl)phenyl]methyl]-2,2-diethoxyethanamine.
| Compound Name | N-[[3-(difluoromethyl)phenyl]methyl]-2,2-diethoxyethanamine |
|---|---|
| PubChem CID | 115526613 |
| Molecular Formula | C14H21F2NO2 |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | N-[[3-(difluoromethyl)phenyl]methyl]-2,2-diethoxyethanamine |
| SMILES | CCOC(CNCc1cccc(C(F)F)c1)OCC |
| InChI | InChI=1S/C14H21F2NO2/c1-3-18-13(19-4-2)10-17-9-11-6-5-7-12(8-11)14(15)16/h5-8,13-14,17H,3-4,9-10H2,1-2H3 |
| InChIKey | XBXSOJGDGVFORX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|