C16H24F2N2O2 — CID 107247607
tert-butyl N-[1-[[3-(difluoromethyl)phenyl]methylamino]propan-2-yl]carbamate (PubChem CID 107247607) has the molecular formula C16H24F2N2O2 and a molecular weight of 314.38 g/mol. Its IUPAC name is tert-butyl N-[1-[[3-(difluoromethyl)phenyl]methylamino]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[3-(difluoromethyl)phenyl]methylamino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 107247607 |
| Molecular Formula | C16H24F2N2O2 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | tert-butyl N-[1-[[3-(difluoromethyl)phenyl]methylamino]propan-2-yl]carbamate |
| SMILES | CC(CNCc1cccc(C(F)F)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H24F2N2O2/c1-11(20-15(21)22-16(2,3)4)9-19-10-12-6-5-7-13(8-12)14(17)18/h5-8,11,14,19H,9-10H2,1-4H3,(H,20,21) |
| InChIKey | RSDOEPBBFQOYTC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |