C11H13F2N — CID 115525877
N-[[3-(difluoromethyl)phenyl]methyl]prop-2-en-1-amine (PubChem CID 115525877) has the molecular formula C11H13F2N and a molecular weight of 197.23 g/mol. Its IUPAC name is N-[[3-(difluoromethyl)phenyl]methyl]prop-2-en-1-amine.
| Compound Name | N-[[3-(difluoromethyl)phenyl]methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 115525877 |
| Molecular Formula | C11H13F2N |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | N-[[3-(difluoromethyl)phenyl]methyl]prop-2-en-1-amine |
| SMILES | C=CCNCc1cccc(C(F)F)c1 |
| InChI | InChI=1S/C11H13F2N/c1-2-6-14-8-9-4-3-5-10(7-9)11(12)13/h2-5,7,11,14H,1,6,8H2 |
| InChIKey | STDQMASDIDNKHF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|