C12H19NO2 — CID 71028738
2-[(3-ethylphenyl)methylamino]propane-1,3-diol (PubChem CID 71028738) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-[(3-ethylphenyl)methylamino]propane-1,3-diol.
| Compound Name | 2-[(3-ethylphenyl)methylamino]propane-1,3-diol |
|---|---|
| PubChem CID | 71028738 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 2-[(3-ethylphenyl)methylamino]propane-1,3-diol |
| SMILES | CCc1cccc(CNC(CO)CO)c1 |
| InChI | InChI=1S/C12H19NO2/c1-2-10-4-3-5-11(6-10)7-13-12(8-14)9-15/h3-6,12-15H,2,7-9H2,1H3 |
| InChIKey | RPEDUTHMBLOOCE-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |