C14H21F2N — CID 115526455
N-[[3-(difluoromethyl)phenyl]methyl]hexan-2-amine (PubChem CID 115526455) has the molecular formula C14H21F2N and a molecular weight of 241.33 g/mol. Its IUPAC name is N-[[3-(difluoromethyl)phenyl]methyl]hexan-2-amine.
| Compound Name | N-[[3-(difluoromethyl)phenyl]methyl]hexan-2-amine |
|---|---|
| PubChem CID | 115526455 |
| Molecular Formula | C14H21F2N |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | N-[[3-(difluoromethyl)phenyl]methyl]hexan-2-amine |
| SMILES | CCCCC(C)NCc1cccc(C(F)F)c1 |
| InChI | InChI=1S/C14H21F2N/c1-3-4-6-11(2)17-10-12-7-5-8-13(9-12)14(15)16/h5,7-9,11,14,17H,3-4,6,10H2,1-2H3 |
| InChIKey | AIYDPCMQQTUDOG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |