C23H20N3O6- — CID 163141526
3-[3-(furan-2-yl)-3-[4-[hydroxy(oxido)amino]anilino]propanoyl]-4-hydroxy-1-methylquinolin-2-one (PubChem CID 163141526) has the molecular formula C23H20N3O6- and a molecular weight of 434.43 g/mol. Its IUPAC name is 3-[3-(furan-2-yl)-3-[4-[hydroxy(oxido)amino]anilino]propanoyl]-4-hydroxy-1-methylquinolin-2-one.
| Compound Name | 3-[3-(furan-2-yl)-3-[4-[hydroxy(oxido)amino]anilino]propanoyl]-4-hydroxy-1-methylquinolin-2-one |
|---|---|
| PubChem CID | 163141526 |
| Molecular Formula | C23H20N3O6- |
| Molecular Weight | 434.43 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 3-[3-(furan-2-yl)-3-[4-[hydroxy(oxido)amino]anilino]propanoyl]-4-hydroxy-1-methylquinolin-2-one |
| SMILES | Cn1c(=O)c(C(=O)CC(Nc2ccc(N([O-])O)cc2)c2ccco2)c(O)c2ccccc21 |
| InChI | InChI=1S/C23H20N3O6/c1-25-18-6-3-2-5-16(18)22(28)21(23(25)29)19(27)13-17(20-7-4-12-32-20)24-14-8-10-15(11-9-14)26(30)31/h2-12,17,24,28,30H,13H2,1H3/q-1 |
| InChIKey | GGSBFMPPKLNDEX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|