C23H21N3O4 — CID 54678179
3-[3-(furan-2-yl)-3-(pyridin-4-ylmethylamino)propanoyl]-4-hydroxy-1-methylquinolin-2-one (PubChem CID 54678179) has the molecular formula C23H21N3O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is 3-[3-(furan-2-yl)-3-(pyridin-4-ylmethylamino)propanoyl]-4-hydroxy-1-methylquinolin-2-one.
| Compound Name | 3-[3-(furan-2-yl)-3-(pyridin-4-ylmethylamino)propanoyl]-4-hydroxy-1-methylquinolin-2-one |
|---|---|
| PubChem CID | 54678179 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 3-[3-(furan-2-yl)-3-(pyridin-4-ylmethylamino)propanoyl]-4-hydroxy-1-methylquinolin-2-one |
| SMILES | Cn1c(=O)c(C(=O)CC(NCc2ccncc2)c2ccco2)c(O)c2ccccc21 |
| InChI | InChI=1S/C23H21N3O4/c1-26-18-6-3-2-5-16(18)22(28)21(23(26)29)19(27)13-17(20-7-4-12-30-20)25-14-15-8-10-24-11-9-15/h2-12,17,25,28H,13-14H2,1H3 |
| InChIKey | GZGBYPXWHWORTQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |