C26H21N3O7 — CID 54747515
3-[(3R)-3-(1,3-benzodioxol-5-yl)-3-(3-nitroanilino)propanoyl]-4-hydroxy-1-methylquinolin-2-one (PubChem CID 54747515) has the molecular formula C26H21N3O7 and a molecular weight of 487.47 g/mol. Its IUPAC name is 3-[(3R)-3-(1,3-benzodioxol-5-yl)-3-(3-nitroanilino)propanoyl]-4-hydroxy-1-methylquinolin-2-one.
| Compound Name | 3-[(3R)-3-(1,3-benzodioxol-5-yl)-3-(3-nitroanilino)propanoyl]-4-hydroxy-1-methylquinolin-2-one |
|---|---|
| PubChem CID | 54747515 |
| Molecular Formula | C26H21N3O7 |
| Molecular Weight | 487.47 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | 3-[(3R)-3-(1,3-benzodioxol-5-yl)-3-(3-nitroanilino)propanoyl]-4-hydroxy-1-methylquinolin-2-one |
| SMILES | Cn1c(=O)c(C(=O)C[C@@H](Nc2cccc([N+](=O)[O-])c2)c2ccc3c(c2)OCO3)c(O)c2ccccc21 |
| InChI | InChI=1S/C26H21N3O7/c1-28-20-8-3-2-7-18(20)25(31)24(26(28)32)21(30)13-19(15-9-10-22-23(11-15)36-14-35-22)27-16-5-4-6-17(12-16)29(33)34/h2-12,19,27,31H,13-14H2,1H3/t19-/m1/s1 |
| InChIKey | JRXHFKVJZLJHRD-LJQANCHMSA-N |
| XLogP | 4.31 |
| TPSA | 132.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.47 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|