C30H25N3O5 — CID 54716445
3-[3-[(8-aminonaphthalen-1-yl)amino]-3-(1,3-benzodioxol-5-yl)propanoyl]-4-hydroxy-1-methylquinolin-2-one (PubChem CID 54716445) has the molecular formula C30H25N3O5 and a molecular weight of 507.55 g/mol. Its IUPAC name is 3-[3-[(8-aminonaphthalen-1-yl)amino]-3-(1,3-benzodioxol-5-yl)propanoyl]-4-hydroxy-1-methylquinolin-2-one.
| Compound Name | 3-[3-[(8-aminonaphthalen-1-yl)amino]-3-(1,3-benzodioxol-5-yl)propanoyl]-4-hydroxy-1-methylquinolin-2-one |
|---|---|
| PubChem CID | 54716445 |
| Molecular Formula | C30H25N3O5 |
| Molecular Weight | 507.55 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | 3-[3-[(8-aminonaphthalen-1-yl)amino]-3-(1,3-benzodioxol-5-yl)propanoyl]-4-hydroxy-1-methylquinolin-2-one |
| SMILES | Cn1c(=O)c(C(=O)CC(Nc2cccc3cccc(N)c23)c2ccc3c(c2)OCO3)c(O)c2ccccc21 |
| InChI | InChI=1S/C30H25N3O5/c1-33-23-11-3-2-8-19(23)29(35)28(30(33)36)24(34)15-22(18-12-13-25-26(14-18)38-16-37-25)32-21-10-5-7-17-6-4-9-20(31)27(17)21/h2-14,22,32,35H,15-16,31H2,1H3 |
| InChIKey | MAKHDQXFWHAQPV-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.55 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|