C18H14O5 — CID 89348583
2-(1,3-benzodioxol-5-yl)-4-(4-methoxyphenyl)but-1-ene-1,4-dione (PubChem CID 89348583) has the molecular formula C18H14O5 and a molecular weight of 310.31 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-4-(4-methoxyphenyl)but-1-ene-1,4-dione.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-4-(4-methoxyphenyl)but-1-ene-1,4-dione |
|---|---|
| PubChem CID | 89348583 |
| Molecular Formula | C18H14O5 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-4-(4-methoxyphenyl)but-1-ene-1,4-dione |
| SMILES | COc1ccc(C(=O)CC(=C=O)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C18H14O5/c1-21-15-5-2-12(3-6-15)16(20)8-14(10-19)13-4-7-17-18(9-13)23-11-22-17/h2-7,9H,8,11H2,1H3 |
| InChIKey | OKZGZDPFGBXQIK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|