C13H16F3NO3 — CID 167488926
1-(1,3-benzodioxol-5-yl)-2-(1,2,2-trifluoroethylamino)ethanone;ethane (PubChem CID 167488926) has the molecular formula C13H16F3NO3 and a molecular weight of 291.27 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-(1,2,2-trifluoroethylamino)ethanone;ethane.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-(1,2,2-trifluoroethylamino)ethanone;ethane |
|---|---|
| PubChem CID | 167488926 |
| Molecular Formula | C13H16F3NO3 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-(1,2,2-trifluoroethylamino)ethanone;ethane |
| SMILES | CC.O=C(CNC(F)C(F)F)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H10F3NO3.C2H6/c12-10(13)11(14)15-4-7(16)6-1-2-8-9(3-6)18-5-17-8;1-2/h1-3,10-11,15H,4-5H2;1-2H3 |
| InChIKey | WRWPZENJVOVITE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|