C19H19Cl2NO3 — CID 7864701
[2-(2,5-diethylphenyl)-2-oxoethyl] 2-amino-3,5-dichlorobenzoate (PubChem CID 7864701) has the molecular formula C19H19Cl2NO3 and a molecular weight of 380.27 g/mol. Its IUPAC name is [2-(2,5-diethylphenyl)-2-oxoethyl] 2-amino-3,5-dichlorobenzoate.
| Compound Name | [2-(2,5-diethylphenyl)-2-oxoethyl] 2-amino-3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 7864701 |
| Molecular Formula | C19H19Cl2NO3 |
| Molecular Weight | 380.27 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | [2-(2,5-diethylphenyl)-2-oxoethyl] 2-amino-3,5-dichlorobenzoate |
| SMILES | CCc1ccc(CC)c(C(=O)COC(=O)c2cc(Cl)cc(Cl)c2N)c1 |
| InChI | InChI=1S/C19H19Cl2NO3/c1-3-11-5-6-12(4-2)14(7-11)17(23)10-25-19(24)15-8-13(20)9-16(21)18(15)22/h5-9H,3-4,10,22H2,1-2H3 |
| InChIKey | YZPOEGXGSZOXCX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.27 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|