C22H26O6 — CID 8013104
[2-(2,5-diethylphenyl)-2-oxoethyl] 3,4,5-trimethoxybenzoate (PubChem CID 8013104) has the molecular formula C22H26O6 and a molecular weight of 386.44 g/mol. Its IUPAC name is [2-(2,5-diethylphenyl)-2-oxoethyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [2-(2,5-diethylphenyl)-2-oxoethyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 8013104 |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | [2-(2,5-diethylphenyl)-2-oxoethyl] 3,4,5-trimethoxybenzoate |
| SMILES | CCc1ccc(CC)c(C(=O)COC(=O)c2cc(OC)c(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C22H26O6/c1-6-14-8-9-15(7-2)17(10-14)18(23)13-28-22(24)16-11-19(25-3)21(27-5)20(12-16)26-4/h8-12H,6-7,13H2,1-5H3 |
| InChIKey | WACZLWGOZCWSGR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |