C25H24O6 — CID 16528099
[2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl] 2-benzylbenzoate (PubChem CID 16528099) has the molecular formula C25H24O6 and a molecular weight of 420.46 g/mol. Its IUPAC name is [2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl] 2-benzylbenzoate.
| Compound Name | [2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl] 2-benzylbenzoate |
|---|---|
| PubChem CID | 16528099 |
| Molecular Formula | C25H24O6 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | [2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl] 2-benzylbenzoate |
| SMILES | COc1cc(C(=O)COC(=O)c2ccccc2Cc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C25H24O6/c1-28-22-14-19(15-23(29-2)24(22)30-3)21(26)16-31-25(27)20-12-8-7-11-18(20)13-17-9-5-4-6-10-17/h4-12,14-15H,13,16H2,1-3H3 |
| InChIKey | CREORWLOWCBPDV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |