C16H18Cl3NO3 — CID 2385493
[2-[[(1R,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] 2,3,6-trichlorobenzoate (PubChem CID 2385493) has the molecular formula C16H18Cl3NO3 and a molecular weight of 378.68 g/mol. Its IUPAC name is [2-[[(1R,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] 2,3,6-trichlorobenzoate.
| Compound Name | [2-[[(1R,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] 2,3,6-trichlorobenzoate |
|---|---|
| PubChem CID | 2385493 |
| Molecular Formula | C16H18Cl3NO3 |
| Molecular Weight | 378.68 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | [2-[[(1R,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] 2,3,6-trichlorobenzoate |
| SMILES | C[C@H]1CCCC[C@H]1NC(=O)COC(=O)c1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C16H18Cl3NO3/c1-9-4-2-3-5-12(9)20-13(21)8-23-16(22)14-10(17)6-7-11(18)15(14)19/h6-7,9,12H,2-5,8H2,1H3,(H,20,21)/t9-,12+/m0/s1 |
| InChIKey | CQZBRCYLAAYRAE-JOYOIKCWSA-N |
| XLogP | 4.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.68 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|