C17H21Cl2NO3 — CID 7917105
2-(2-acetyl-4,6-dichlorophenoxy)-N-[(1R,2S)-2-methylcyclohexyl]acetamide (PubChem CID 7917105) has the molecular formula C17H21Cl2NO3 and a molecular weight of 358.27 g/mol. Its IUPAC name is 2-(2-acetyl-4,6-dichlorophenoxy)-N-[(1R,2S)-2-methylcyclohexyl]acetamide.
| Compound Name | 2-(2-acetyl-4,6-dichlorophenoxy)-N-[(1R,2S)-2-methylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 7917105 |
| Molecular Formula | C17H21Cl2NO3 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 2-(2-acetyl-4,6-dichlorophenoxy)-N-[(1R,2S)-2-methylcyclohexyl]acetamide |
| SMILES | CC(=O)c1cc(Cl)cc(Cl)c1OCC(=O)N[C@@H]1CCCC[C@@H]1C |
| InChI | InChI=1S/C17H21Cl2NO3/c1-10-5-3-4-6-15(10)20-16(22)9-23-17-13(11(2)21)7-12(18)8-14(17)19/h7-8,10,15H,3-6,9H2,1-2H3,(H,20,22)/t10-,15+/m0/s1 |
| InChIKey | ORVXOGBFNMGFET-ZUZCIYMTSA-N |
| XLogP | 4.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |