C16H16Cl2N2O5 — CID 2510840
[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl] 4-(2,4-dichlorophenoxy)butanoate (PubChem CID 2510840) has the molecular formula C16H16Cl2N2O5 and a molecular weight of 387.22 g/mol. Its IUPAC name is [2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl] 4-(2,4-dichlorophenoxy)butanoate.
| Compound Name | [2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl] 4-(2,4-dichlorophenoxy)butanoate |
|---|---|
| PubChem CID | 2510840 |
| Molecular Formula | C16H16Cl2N2O5 |
| Molecular Weight | 387.22 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | [2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl] 4-(2,4-dichlorophenoxy)butanoate |
| SMILES | Cc1cc(NC(=O)COC(=O)CCCOc2ccc(Cl)cc2Cl)no1 |
| InChI | InChI=1S/C16H16Cl2N2O5/c1-10-7-14(20-25-10)19-15(21)9-24-16(22)3-2-6-23-13-5-4-11(17)8-12(13)18/h4-5,7-8H,2-3,6,9H2,1H3,(H,19,20,21) |
| InChIKey | MPYKPXRMAYSEHF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.22 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|