C27H27ClN2O4 — CID 2386650
[2-[(9-ethylcarbazol-3-yl)amino]-2-oxoethyl] 4-(4-chloro-2-methylphenoxy)butanoate (PubChem CID 2386650) has the molecular formula C27H27ClN2O4 and a molecular weight of 478.98 g/mol. Its IUPAC name is [2-[(9-ethylcarbazol-3-yl)amino]-2-oxoethyl] 4-(4-chloro-2-methylphenoxy)butanoate.
| Compound Name | [2-[(9-ethylcarbazol-3-yl)amino]-2-oxoethyl] 4-(4-chloro-2-methylphenoxy)butanoate |
|---|---|
| PubChem CID | 2386650 |
| Molecular Formula | C27H27ClN2O4 |
| Molecular Weight | 478.98 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | [2-[(9-ethylcarbazol-3-yl)amino]-2-oxoethyl] 4-(4-chloro-2-methylphenoxy)butanoate |
| SMILES | CCn1c2ccccc2c2cc(NC(=O)COC(=O)CCCOc3ccc(Cl)cc3C)ccc21 |
| InChI | InChI=1S/C27H27ClN2O4/c1-3-30-23-8-5-4-7-21(23)22-16-20(11-12-24(22)30)29-26(31)17-34-27(32)9-6-14-33-25-13-10-19(28)15-18(25)2/h4-5,7-8,10-13,15-16H,3,6,9,14,17H2,1-2H3,(H,29,31) |
| InChIKey | LDLCNUOBAZTLOY-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.98 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|