C24H28ClNO5 — CID 16556563
[2-[4-(2,2-dimethylpropanoylamino)phenyl]-2-oxoethyl] 4-(4-chloro-2-methylphenoxy)butanoate (PubChem CID 16556563) has the molecular formula C24H28ClNO5 and a molecular weight of 445.94 g/mol. Its IUPAC name is [2-[4-(2,2-dimethylpropanoylamino)phenyl]-2-oxoethyl] 4-(4-chloro-2-methylphenoxy)butanoate.
| Compound Name | [2-[4-(2,2-dimethylpropanoylamino)phenyl]-2-oxoethyl] 4-(4-chloro-2-methylphenoxy)butanoate |
|---|---|
| PubChem CID | 16556563 |
| Molecular Formula | C24H28ClNO5 |
| Molecular Weight | 445.94 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | [2-[4-(2,2-dimethylpropanoylamino)phenyl]-2-oxoethyl] 4-(4-chloro-2-methylphenoxy)butanoate |
| SMILES | Cc1cc(Cl)ccc1OCCCC(=O)OCC(=O)c1ccc(NC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H28ClNO5/c1-16-14-18(25)9-12-21(16)30-13-5-6-22(28)31-15-20(27)17-7-10-19(11-8-17)26-23(29)24(2,3)4/h7-12,14H,5-6,13,15H2,1-4H3,(H,26,29) |
| InChIKey | BRUDDBMPZMNVIO-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.94 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|