C21H21Cl2NO5S — CID 26968947
[2-(3-acetamido-4-methylsulfanylphenyl)-2-oxoethyl] 4-(2,4-dichlorophenoxy)butanoate (PubChem CID 26968947) has the molecular formula C21H21Cl2NO5S and a molecular weight of 470.37 g/mol. Its IUPAC name is [2-(3-acetamido-4-methylsulfanylphenyl)-2-oxoethyl] 4-(2,4-dichlorophenoxy)butanoate.
| Compound Name | [2-(3-acetamido-4-methylsulfanylphenyl)-2-oxoethyl] 4-(2,4-dichlorophenoxy)butanoate |
|---|---|
| PubChem CID | 26968947 |
| Molecular Formula | C21H21Cl2NO5S |
| Molecular Weight | 470.37 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | [2-(3-acetamido-4-methylsulfanylphenyl)-2-oxoethyl] 4-(2,4-dichlorophenoxy)butanoate |
| SMILES | CSc1ccc(C(=O)COC(=O)CCCOc2ccc(Cl)cc2Cl)cc1NC(C)=O |
| InChI | InChI=1S/C21H21Cl2NO5S/c1-13(25)24-17-10-14(5-8-20(17)30-2)18(26)12-29-21(27)4-3-9-28-19-7-6-15(22)11-16(19)23/h5-8,10-11H,3-4,9,12H2,1-2H3,(H,24,25) |
| InChIKey | UGEMAUZSPNOJFF-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.37 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|