C25H29NO6S — CID 27197789
[2-(3-acetamido-4-methylsulfanylphenyl)-2-oxoethyl] (E)-3-(3-ethoxy-4-propoxyphenyl)prop-2-enoate (PubChem CID 27197789) has the molecular formula C25H29NO6S and a molecular weight of 471.58 g/mol. Its IUPAC name is [2-(3-acetamido-4-methylsulfanylphenyl)-2-oxoethyl] (E)-3-(3-ethoxy-4-propoxyphenyl)prop-2-enoate.
| Compound Name | [2-(3-acetamido-4-methylsulfanylphenyl)-2-oxoethyl] (E)-3-(3-ethoxy-4-propoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 27197789 |
| Molecular Formula | C25H29NO6S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | [2-(3-acetamido-4-methylsulfanylphenyl)-2-oxoethyl] (E)-3-(3-ethoxy-4-propoxyphenyl)prop-2-enoate |
| SMILES | CCCOc1ccc(/C=C/C(=O)OCC(=O)c2ccc(SC)c(NC(C)=O)c2)cc1OCC |
| InChI | InChI=1S/C25H29NO6S/c1-5-13-31-22-10-7-18(14-23(22)30-6-2)8-12-25(29)32-16-21(28)19-9-11-24(33-4)20(15-19)26-17(3)27/h7-12,14-15H,5-6,13,16H2,1-4H3,(H,26,27)/b12-8+ |
| InChIKey | CSMLWYDQKHXUGJ-XYOKQWHBSA-N |
| XLogP | 4.99 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|