C24H30N2O4 — CID 55782534
3-[3-(3-ethoxy-4-propoxyphenyl)prop-2-enoylamino]-N-ethyl-4-methylbenzamide (PubChem CID 55782534) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is 3-[3-(3-ethoxy-4-propoxyphenyl)prop-2-enoylamino]-N-ethyl-4-methylbenzamide.
| Compound Name | 3-[3-(3-ethoxy-4-propoxyphenyl)prop-2-enoylamino]-N-ethyl-4-methylbenzamide |
|---|---|
| PubChem CID | 55782534 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 3-[3-(3-ethoxy-4-propoxyphenyl)prop-2-enoylamino]-N-ethyl-4-methylbenzamide |
| SMILES | CCCOc1ccc(C=CC(=O)Nc2cc(C(=O)NCC)ccc2C)cc1OCC |
| InChI | InChI=1S/C24H30N2O4/c1-5-14-30-21-12-9-18(15-22(21)29-7-3)10-13-23(27)26-20-16-19(11-8-17(20)4)24(28)25-6-2/h8-13,15-16H,5-7,14H2,1-4H3,(H,25,28)(H,26,27) |
| InChIKey | FVAXLGQWQWVNAY-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|