C21H21BrF3NO3 — CID 2474207
(E)-N-[4-bromo-3-(trifluoromethyl)phenyl]-3-(3-ethoxy-4-propoxyphenyl)prop-2-enamide (PubChem CID 2474207) has the molecular formula C21H21BrF3NO3 and a molecular weight of 472.30 g/mol. Its IUPAC name is (E)-N-[4-bromo-3-(trifluoromethyl)phenyl]-3-(3-ethoxy-4-propoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-bromo-3-(trifluoromethyl)phenyl]-3-(3-ethoxy-4-propoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2474207 |
| Molecular Formula | C21H21BrF3NO3 |
| Molecular Weight | 472.30 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | (E)-N-[4-bromo-3-(trifluoromethyl)phenyl]-3-(3-ethoxy-4-propoxyphenyl)prop-2-enamide |
| SMILES | CCCOc1ccc(/C=C/C(=O)Nc2ccc(Br)c(C(F)(F)F)c2)cc1OCC |
| InChI | InChI=1S/C21H21BrF3NO3/c1-3-11-29-18-9-5-14(12-19(18)28-4-2)6-10-20(27)26-15-7-8-17(22)16(13-15)21(23,24)25/h5-10,12-13H,3-4,11H2,1-2H3,(H,26,27)/b10-6+ |
| InChIKey | PHHQXXVROCBGBE-UXBLZVDNSA-N |
| XLogP | 6.31 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.30 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|