C23H29N3O6 — CID 46561306
ethyl 2,5-dimethyl-1-[2-[2-(4-morpholin-4-ylanilino)-2-oxoethoxy]-2-oxoethyl]pyrrole-3-carboxylate (PubChem CID 46561306) has the molecular formula C23H29N3O6 and a molecular weight of 443.50 g/mol. Its IUPAC name is ethyl 2,5-dimethyl-1-[2-[2-(4-morpholin-4-ylanilino)-2-oxoethoxy]-2-oxoethyl]pyrrole-3-carboxylate.
| Compound Name | ethyl 2,5-dimethyl-1-[2-[2-(4-morpholin-4-ylanilino)-2-oxoethoxy]-2-oxoethyl]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 46561306 |
| Molecular Formula | C23H29N3O6 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | ethyl 2,5-dimethyl-1-[2-[2-(4-morpholin-4-ylanilino)-2-oxoethoxy]-2-oxoethyl]pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C)n(CC(=O)OCC(=O)Nc2ccc(N3CCOCC3)cc2)c1C |
| InChI | InChI=1S/C23H29N3O6/c1-4-31-23(29)20-13-16(2)26(17(20)3)14-22(28)32-15-21(27)24-18-5-7-19(8-6-18)25-9-11-30-12-10-25/h5-8,13H,4,9-12,14-15H2,1-3H3,(H,24,27) |
| InChIKey | DKPUGTSIACCHDY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|