C18H19N3O8S2 — CID 23938698
[2-(2-nitroanilino)-2-oxoethyl] 2-(5-morpholin-4-ylsulfonylthiophen-2-yl)acetate (PubChem CID 23938698) has the molecular formula C18H19N3O8S2 and a molecular weight of 469.50 g/mol. Its IUPAC name is [2-(2-nitroanilino)-2-oxoethyl] 2-(5-morpholin-4-ylsulfonylthiophen-2-yl)acetate.
| Compound Name | [2-(2-nitroanilino)-2-oxoethyl] 2-(5-morpholin-4-ylsulfonylthiophen-2-yl)acetate |
|---|---|
| PubChem CID | 23938698 |
| Molecular Formula | C18H19N3O8S2 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | [2-(2-nitroanilino)-2-oxoethyl] 2-(5-morpholin-4-ylsulfonylthiophen-2-yl)acetate |
| SMILES | O=C(COC(=O)Cc1ccc(S(=O)(=O)N2CCOCC2)s1)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H19N3O8S2/c22-16(19-14-3-1-2-4-15(14)21(24)25)12-29-17(23)11-13-5-6-18(30-13)31(26,27)20-7-9-28-10-8-20/h1-6H,7-12H2,(H,19,22) |
| InChIKey | TWOXXFDNVWCGEC-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|