C18H20FN3O6S2 — CID 25161889
N'-[2-(3-fluorophenoxy)acetyl]-2-(5-morpholin-4-ylsulfonylthiophen-2-yl)acetohydrazide (PubChem CID 25161889) has the molecular formula C18H20FN3O6S2 and a molecular weight of 457.51 g/mol. Its IUPAC name is N'-[2-(3-fluorophenoxy)acetyl]-2-(5-morpholin-4-ylsulfonylthiophen-2-yl)acetohydrazide.
| Compound Name | N'-[2-(3-fluorophenoxy)acetyl]-2-(5-morpholin-4-ylsulfonylthiophen-2-yl)acetohydrazide |
|---|---|
| PubChem CID | 25161889 |
| Molecular Formula | C18H20FN3O6S2 |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | N'-[2-(3-fluorophenoxy)acetyl]-2-(5-morpholin-4-ylsulfonylthiophen-2-yl)acetohydrazide |
| SMILES | O=C(COc1cccc(F)c1)NNC(=O)Cc1ccc(S(=O)(=O)N2CCOCC2)s1 |
| InChI | InChI=1S/C18H20FN3O6S2/c19-13-2-1-3-14(10-13)28-12-17(24)21-20-16(23)11-15-4-5-18(29-15)30(25,26)22-6-8-27-9-7-22/h1-5,10H,6-9,11-12H2,(H,20,23)(H,21,24) |
| InChIKey | RITSUZKEHZZLRJ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|